Ascorbic Acid C6H8O8 AR 500g
| grade | Laboratory reagent, |
| InChI Key | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| grade | puriss. p.a. |
| assay | 99.7-100.5% (oxidimetric) |
| form | solid |
| optical activity | [��]20/D +20.5 to +21.5��, c = 10% in H2O |
| application(s) | cell analysis: suitable |
| impurities | related substances, in accordance (HPLC) |
| ���0.001% heavy metals (by ICP-OES) | |
| ign. residue | ���0.05% (as SO4) |
| loss | ���0.1% loss on drying, 105 ��C |
| pH | 2.1-2.6 (20 ��C, 5%) |
| mp | 190-194 ��C (dec.) |
| solubility | water: soluble 176 g/L at 20 ��C |
| anion traces | chloride (Cl���): ���50 mg/kg |
| sulfate (SO42-): ���20 mg/kg | |
| cation traces | As: ���1 mg/kg |
| Cu: ���5 mg/kg | |
| Fe: ���2 mg/kg | |
| Pb: ���5 mg/kg | |
| Zn: ���10 mg/kg | |
| suitability | complies for appearance of solution |
| passes test for identity (IR) | |
| Agency/Method | Ph Eur |
| SMILES string | OC([C@]([C@@H](O)CO)([H])O1)=C(O)C1=O |
| Gene Information | human ��� SLC23A2(996 |
Related products
Laboratory Chemicals
R10 988,00
Laboratory Chemicals
R1 075,00
Laboratory Chemicals
R210,00
Laboratory Chemicals
R2 580,00
Laboratory Chemicals
R5 945,00
Laboratory Chemicals
R450,00
Laboratory Chemicals
R9 885,00
Laboratory Chemicals
R405,00